About (4S)-2,2-dimethyl-4-[4-(6-sulfamoyl-2-pyridinyl)butyl]pyrrolidine-1-carboxylic acid
(4S)-2,2-dimethyl-4-[4-(6-sulfamoyl-2-pyridinyl)butyl]pyrrolidine-1-carboxylic acid (PubChem CID 139416595) has the molecular formula C16H25N3O4S
and a molecular weight of 355.46 g/mol. Its IUPAC name is (4S)-2,2-dimethyl-4-[4-(6-sulfamoyl-2-pyridinyl)butyl]pyrrolidine-1-carboxylic acid.
Molecular Properties
| Compound Name | (4S)-2,2-dimethyl-4-[4-(6-sulfamoyl-2-pyridinyl)butyl]pyrrolidine-1-carboxylic acid |
| PubChem CID | 139416595 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (4S)-2,2-dimethyl-4-[4-(6-sulfamoyl-2-pyridinyl)butyl]pyrrolidine-1-carboxylic acid |
| SMILES | CC1(C)C[C@H](CCCCc2cccc(S(N)(=O)=O)n2)CN1C(=O)O |
| InChI | InChI=1S/C16H25N3O4S/c1-16(2)10-12(11-19(16)15(20)21)6-3-4-7-13-8-5-9-14(18-13)24(17,22)23/h5,8-9,12H,3-4,6-7,10-11H2,1-2H3,(H,20,21)(H2,17,22,23)/t12-/m0/s1 |
| InChIKey | JFQOGNLJQSIGQV-LBPRGKRZSA-N |
| XLogP | 2.22 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4S)-2,2-dimethyl-4-[4-(6-sulfamoyl-2-pyridinyl)butyl]pyrrolidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,2-dimethyl-4-[4-(6-sulfamoyl-2-pyridinyl)butyl]pyrrolidine-1-carboxylic acid?
The IUPAC name of (4S)-2,2-dimethyl-4-[4-(6-sulfamoyl-2-pyridinyl)butyl]pyrrolidine-1-carboxylic acid (CID 139416595) is (4S)-2,2-dimethyl-4-[4-(6-sulfamoyl-2-pyridinyl)butyl]pyrrolidine-1-carboxylic acid.
What is the SMILES notation for (4S)-2,2-dimethyl-4-[4-(6-sulfamoyl-2-pyridinyl)butyl]pyrrolidine-1-carboxylic acid?
The canonical SMILES for (4S)-2,2-dimethyl-4-[4-(6-sulfamoyl-2-pyridinyl)butyl]pyrrolidine-1-carboxylic acid is CC1(C)C[C@H](CCCCc2cccc(S(N)(=O)=O)n2)CN1C(=O)O.
What is the InChIKey of (4S)-2,2-dimethyl-4-[4-(6-sulfamoyl-2-pyridinyl)butyl]pyrrolidine-1-carboxylic acid?
The InChIKey is JFQOGNLJQSIGQV-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H25N3O4S/c1-16(2)10-12(11-19(16)15(20)21)6-3-4-7-13-8-5-9-14(18-13)24(17,22)23/h5,8-9,12H,3-4,6-7,10-11H2,1-2H3,(H,20,21)(H2,17,22,23)/t12-/m0/s1.
What are the key properties of (4S)-2,2-dimethyl-4-[4-(6-sulfamoyl-2-pyridinyl)butyl]pyrrolidine-1-carboxylic acid?
(4S)-2,2-dimethyl-4-[4-(6-sulfamoyl-2-pyridinyl)butyl]pyrrolidine-1-carboxylic acid has a molecular weight of 355.46 g/mol, XLogP of 2.22, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,2-dimethyl-4-[4-(6-sulfamoyl-2-pyridinyl)butyl]pyrrolidine-1-carboxylic acid is sourced from PubChem (CID 139416595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).