C24H32N4O6 — CID 139416868
methyl (2R)-2-[[(2S,11S)-11-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carbonyl]amino]propanoate (PubChem CID 139416868) has the molecular formula C24H32N4O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is methyl (2R)-2-[[(2S,11S)-11-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carbonyl]amino]propanoate.
| Compound Name | methyl (2R)-2-[[(2S,11S)-11-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 139416868 |
| Molecular Formula | C24H32N4O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | methyl (2R)-2-[[(2S,11S)-11-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carbonyl]amino]propanoate |
| SMILES | COC(=O)[C@@H](C)NC(=O)[C@@H]1Cc2cccc3c2N1C(=O)[C@@H](NC(=O)[C@@H](NC(C)=O)C(C)C)CC3 |
| InChI | InChI=1S/C24H32N4O6/c1-12(2)19(26-14(4)29)22(31)27-17-10-9-15-7-6-8-16-11-18(28(20(15)16)23(17)32)21(30)25-13(3)24(33)34-5/h6-8,12-13,17-19H,9-11H2,1-5H3,(H,25,30)(H,26,29)(H,27,31)/t13-,17+,18+,19+/m1/s1 |
| InChIKey | XARDHIZBPKZJPO-RPTUDFQQSA-N |
| XLogP | 0.21 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |