About (4E)-N-methyl-4-prop-2-enylidene-1,3-thiazol-5-imine
(4E)-N-methyl-4-prop-2-enylidene-1,3-thiazol-5-imine (PubChem CID 139417005) has the molecular formula C7H8N2S
and a molecular weight of 152.22 g/mol. Its IUPAC name is (4E)-N-methyl-4-prop-2-enylidene-1,3-thiazol-5-imine.
Molecular Properties
| Compound Name | (4E)-N-methyl-4-prop-2-enylidene-1,3-thiazol-5-imine |
| PubChem CID | 139417005 |
| Molecular Formula | C7H8N2S |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | (4E)-N-methyl-4-prop-2-enylidene-1,3-thiazol-5-imine |
| SMILES | C=C/C=C1/N=CS/C1=N\C |
| InChI | InChI=1S/C7H8N2S/c1-3-4-6-7(8-2)10-5-9-6/h3-5H,1H2,2H3/b6-4+,8-7- |
| InChIKey | XBQCGDROVWUSGJ-AQXDOAQYSA-N |
| XLogP | 1.86 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (4E)-N-methyl-4-prop-2-enylidene-1,3-thiazol-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-N-methyl-4-prop-2-enylidene-1,3-thiazol-5-imine?
The IUPAC name of (4E)-N-methyl-4-prop-2-enylidene-1,3-thiazol-5-imine (CID 139417005) is (4E)-N-methyl-4-prop-2-enylidene-1,3-thiazol-5-imine.
What is the SMILES notation for (4E)-N-methyl-4-prop-2-enylidene-1,3-thiazol-5-imine?
The canonical SMILES for (4E)-N-methyl-4-prop-2-enylidene-1,3-thiazol-5-imine is C=C/C=C1/N=CS/C1=N\C.
What is the InChIKey of (4E)-N-methyl-4-prop-2-enylidene-1,3-thiazol-5-imine?
The InChIKey is XBQCGDROVWUSGJ-AQXDOAQYSA-N. The full InChI is InChI=1S/C7H8N2S/c1-3-4-6-7(8-2)10-5-9-6/h3-5H,1H2,2H3/b6-4+,8-7-.
What are the key properties of (4E)-N-methyl-4-prop-2-enylidene-1,3-thiazol-5-imine?
(4E)-N-methyl-4-prop-2-enylidene-1,3-thiazol-5-imine has a molecular weight of 152.22 g/mol, XLogP of 1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-N-methyl-4-prop-2-enylidene-1,3-thiazol-5-imine is sourced from PubChem (CID 139417005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).