C26H24ClN3O5 — CID 139417654
(6aS)-9-[(Z)-but-1-en-3-ynyl]-3-[[3-(chloromethyl)-5-nitrophenyl]methoxy]-2-methoxy-8-methyl-5,6,6a,7-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 139417654) has the molecular formula C26H24ClN3O5 and a molecular weight of 493.95 g/mol. Its IUPAC name is (6aS)-9-[(Z)-but-1-en-3-ynyl]-3-[[3-(chloromethyl)-5-nitrophenyl]methoxy]-2-methoxy-8-methyl-5,6,6a,7-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | (6aS)-9-[(Z)-but-1-en-3-ynyl]-3-[[3-(chloromethyl)-5-nitrophenyl]methoxy]-2-methoxy-8-methyl-5,6,6a,7-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 139417654 |
| Molecular Formula | C26H24ClN3O5 |
| Molecular Weight | 493.95 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | (6aS)-9-[(Z)-but-1-en-3-ynyl]-3-[[3-(chloromethyl)-5-nitrophenyl]methoxy]-2-methoxy-8-methyl-5,6,6a,7-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | C#C/C=C\C1=C(C)C[C@H]2CNc3cc(OCc4cc(CCl)cc([N+](=O)[O-])c4)c(OC)cc3C(=O)N12 |
| InChI | InChI=1S/C26H24ClN3O5/c1-4-5-6-23-16(2)7-20-14-28-22-12-25(24(34-3)11-21(22)26(31)29(20)23)35-15-18-8-17(13-27)9-19(10-18)30(32)33/h1,5-6,8-12,20,28H,7,13-15H2,2-3H3/b6-5-/t20-/m0/s1 |
| InChIKey | HXICZXMYCCIUSO-PRPIBZDOSA-N |
| XLogP | 5.02 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.95 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|