C15H23N3O2 — CID 139417873
(3Z)-3-[(E)-2-(ethylideneamino)-3,4,4-trimethylpent-2-enylidene]-1-methylpiperazine-2,5-dione (PubChem CID 139417873) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is (3Z)-3-[(E)-2-(ethylideneamino)-3,4,4-trimethylpent-2-enylidene]-1-methylpiperazine-2,5-dione.
| Compound Name | (3Z)-3-[(E)-2-(ethylideneamino)-3,4,4-trimethylpent-2-enylidene]-1-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 139417873 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (3Z)-3-[(E)-2-(ethylideneamino)-3,4,4-trimethylpent-2-enylidene]-1-methylpiperazine-2,5-dione |
| SMILES | C/C=N/C(/C=C1\NC(=O)CN(C)C1=O)=C(\C)C(C)(C)C |
| InChI | InChI=1S/C15H23N3O2/c1-7-16-11(10(2)15(3,4)5)8-12-14(20)18(6)9-13(19)17-12/h7-8H,9H2,1-6H3,(H,17,19)/b11-10+,12-8-,16-7+ |
| InChIKey | JPSYLWYERLWSBW-XAPJPKJJSA-N |
| XLogP | 1.87 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|