C29H35N7O4 — CID 139418012
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[6-[2-[4-(3-morpholin-4-ylpropoxy)phenyl]ethynyl]-3,3a-dihydropyrazolo[1,5-a]pyrimidin-2-yl]urea (PubChem CID 139418012) has the molecular formula C29H35N7O4 and a molecular weight of 545.64 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[6-[2-[4-(3-morpholin-4-ylpropoxy)phenyl]ethynyl]-3,3a-dihydropyrazolo[1,5-a]pyrimidin-2-yl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[6-[2-[4-(3-morpholin-4-ylpropoxy)phenyl]ethynyl]-3,3a-dihydropyrazolo[1,5-a]pyrimidin-2-yl]urea |
|---|---|
| PubChem CID | 139418012 |
| Molecular Formula | C29H35N7O4 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[6-[2-[4-(3-morpholin-4-ylpropoxy)phenyl]ethynyl]-3,3a-dihydropyrazolo[1,5-a]pyrimidin-2-yl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)NC2=NN3C=C(C#Cc4ccc(OCCCN5CCOCC5)cc4)C=NC3C2)no1 |
| InChI | InChI=1S/C29H35N7O4/c1-29(2,3)24-17-26(34-40-24)32-28(37)31-25-18-27-30-19-22(20-36(27)33-25)6-5-21-7-9-23(10-8-21)39-14-4-11-35-12-15-38-16-13-35/h7-10,17,19-20,27H,4,11-16,18H2,1-3H3,(H2,31,32,33,34,37) |
| InChIKey | IRXNQOAQXNSVLS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|