C30H46N6 — CID 139418044
N-[(Z)-4-[4-[(3-tert-butyl-2H-pyrrol-5-yl)amino]cyclohexa-1,5-dien-1-yl]-1-[methyl(4-piperidin-1-ylbutyl)amino]but-1-en-3-yn-2-yl]-N'-methylmethanimidamide (PubChem CID 139418044) has the molecular formula C30H46N6 and a molecular weight of 490.74 g/mol. Its IUPAC name is N-[(Z)-4-[4-[(3-tert-butyl-2H-pyrrol-5-yl)amino]cyclohexa-1,5-dien-1-yl]-1-[methyl(4-piperidin-1-ylbutyl)amino]but-1-en-3-yn-2-yl]-N'-methylmethanimidamide.
| Compound Name | N-[(Z)-4-[4-[(3-tert-butyl-2H-pyrrol-5-yl)amino]cyclohexa-1,5-dien-1-yl]-1-[methyl(4-piperidin-1-ylbutyl)amino]but-1-en-3-yn-2-yl]-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 139418044 |
| Molecular Formula | C30H46N6 |
| Molecular Weight | 490.74 g/mol |
| Exact Mass | 490.38 |
| IUPAC Name | N-[(Z)-4-[4-[(3-tert-butyl-2H-pyrrol-5-yl)amino]cyclohexa-1,5-dien-1-yl]-1-[methyl(4-piperidin-1-ylbutyl)amino]but-1-en-3-yn-2-yl]-N'-methylmethanimidamide |
| SMILES | C/N=C/N/C(C#CC1=CCC(NC2=NCC(C(C)(C)C)=C2)C=C1)=C\N(C)CCCCN1CCCCC1 |
| InChI | InChI=1S/C30H46N6/c1-30(2,3)26-21-29(32-22-26)34-27-14-11-25(12-15-27)13-16-28(33-24-31-4)23-35(5)17-9-10-20-36-18-7-6-8-19-36/h11-12,14,21,23-24,27H,6-10,15,17-20,22H2,1-5H3,(H,31,33)(H,32,34)/b28-23- |
| InChIKey | GWISZKOCYMEENC-NFFVHWSESA-N |
| XLogP | 4.51 |
| TPSA | 55.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.74 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|