C23H36N2OS — CID 139418089
(13R)-17-[3-(dimethylamino)propylamino]-13-methylsulfanyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 139418089) has the molecular formula C23H36N2OS and a molecular weight of 388.62 g/mol. Its IUPAC name is (13R)-17-[3-(dimethylamino)propylamino]-13-methylsulfanyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (13R)-17-[3-(dimethylamino)propylamino]-13-methylsulfanyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 139418089 |
| Molecular Formula | C23H36N2OS |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (13R)-17-[3-(dimethylamino)propylamino]-13-methylsulfanyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CS[C@]12CCC3c4ccc(O)cc4CCC3C1CCC2NCCCN(C)C |
| InChI | InChI=1S/C23H36N2OS/c1-25(2)14-4-13-24-22-10-9-21-20-7-5-16-15-17(26)6-8-18(16)19(20)11-12-23(21,22)27-3/h6,8,15,19-22,24,26H,4-5,7,9-14H2,1-3H3/t19?,20?,21?,22?,23-/m1/s1 |
| InChIKey | QJEVJLYVBXOAQV-PMNLSXDQSA-N |
| XLogP | 4.25 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|