C17H25FN2 — CID 139418781
N'-[(3E,5Z)-7-fluoro-2-methylhepta-1,3,5-trien-3-yl]-N-[(3E)-penta-1,3-dien-3-yl]butanimidamide (PubChem CID 139418781) has the molecular formula C17H25FN2 and a molecular weight of 276.40 g/mol. Its IUPAC name is N'-[(3E,5Z)-7-fluoro-2-methylhepta-1,3,5-trien-3-yl]-N-[(3E)-penta-1,3-dien-3-yl]butanimidamide.
| Compound Name | N'-[(3E,5Z)-7-fluoro-2-methylhepta-1,3,5-trien-3-yl]-N-[(3E)-penta-1,3-dien-3-yl]butanimidamide |
|---|---|
| PubChem CID | 139418781 |
| Molecular Formula | C17H25FN2 |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | N'-[(3E,5Z)-7-fluoro-2-methylhepta-1,3,5-trien-3-yl]-N-[(3E)-penta-1,3-dien-3-yl]butanimidamide |
| SMILES | C=C/C(=C\C)N/C(CCC)=N/C(=C/C=C\CF)C(=C)C |
| InChI | InChI=1S/C17H25FN2/c1-6-11-17(19-15(7-2)8-3)20-16(14(4)5)12-9-10-13-18/h7-10,12H,2,4,6,11,13H2,1,3,5H3,(H,19,20)/b10-9-,15-8+,16-12+ |
| InChIKey | AOOTZWIYJWEVML-ZGDKCSANSA-N |
| XLogP | 4.85 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|