About (2E,3E)-2-ethylidene-4-methylsulfonylhexa-3,5-dien-1-amine
(2E,3E)-2-ethylidene-4-methylsulfonylhexa-3,5-dien-1-amine (PubChem CID 139418819) has the molecular formula C9H15NO2S
and a molecular weight of 201.29 g/mol. Its IUPAC name is (2E,3E)-2-ethylidene-4-methylsulfonylhexa-3,5-dien-1-amine.
Molecular Properties
| Compound Name | (2E,3E)-2-ethylidene-4-methylsulfonylhexa-3,5-dien-1-amine |
| PubChem CID | 139418819 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | (2E,3E)-2-ethylidene-4-methylsulfonylhexa-3,5-dien-1-amine |
| SMILES | C=C/C(=C\C(=C/C)CN)S(C)(=O)=O |
| InChI | InChI=1S/C9H15NO2S/c1-4-8(7-10)6-9(5-2)13(3,11)12/h4-6H,2,7,10H2,1,3H3/b8-4+,9-6+ |
| InChIKey | LCUKKYKBZONENI-HNJDCKIISA-N |
| XLogP | 1.01 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,3E)-2-ethylidene-4-methylsulfonylhexa-3,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3E)-2-ethylidene-4-methylsulfonylhexa-3,5-dien-1-amine?
The IUPAC name of (2E,3E)-2-ethylidene-4-methylsulfonylhexa-3,5-dien-1-amine (CID 139418819) is (2E,3E)-2-ethylidene-4-methylsulfonylhexa-3,5-dien-1-amine.
What is the SMILES notation for (2E,3E)-2-ethylidene-4-methylsulfonylhexa-3,5-dien-1-amine?
The canonical SMILES for (2E,3E)-2-ethylidene-4-methylsulfonylhexa-3,5-dien-1-amine is C=C/C(=C\C(=C/C)CN)S(C)(=O)=O.
What is the InChIKey of (2E,3E)-2-ethylidene-4-methylsulfonylhexa-3,5-dien-1-amine?
The InChIKey is LCUKKYKBZONENI-HNJDCKIISA-N. The full InChI is InChI=1S/C9H15NO2S/c1-4-8(7-10)6-9(5-2)13(3,11)12/h4-6H,2,7,10H2,1,3H3/b8-4+,9-6+.
What are the key properties of (2E,3E)-2-ethylidene-4-methylsulfonylhexa-3,5-dien-1-amine?
(2E,3E)-2-ethylidene-4-methylsulfonylhexa-3,5-dien-1-amine has a molecular weight of 201.29 g/mol, XLogP of 1.01, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3E)-2-ethylidene-4-methylsulfonylhexa-3,5-dien-1-amine is sourced from PubChem (CID 139418819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).