C23H20N4O2S — CID 139419028
3-methyl-10-[(E)-3-[5-(methylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoyl]-5-thia-10-azatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one (PubChem CID 139419028) has the molecular formula C23H20N4O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is 3-methyl-10-[(E)-3-[5-(methylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoyl]-5-thia-10-azatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one.
| Compound Name | 3-methyl-10-[(E)-3-[5-(methylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoyl]-5-thia-10-azatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one |
|---|---|
| PubChem CID | 139419028 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 3-methyl-10-[(E)-3-[5-(methylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoyl]-5-thia-10-azatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one |
| SMILES | CNc1cnc2[nH]cc(/C=C/C(=O)N3CC4CC45C3=CC(=O)c3scc(C)c35)c2c1 |
| InChI | InChI=1S/C23H20N4O2S/c1-12-11-30-21-17(28)6-18-23(20(12)21)7-14(23)10-27(18)19(29)4-3-13-8-25-22-16(13)5-15(24-2)9-26-22/h3-6,8-9,11,14,24H,7,10H2,1-2H3,(H,25,26)/b4-3+ |
| InChIKey | AXDHYCHFEWWVBT-ONEGZZNKSA-N |
| XLogP | 3.87 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|