C30H38N2 — CID 139419064
2-methyl-3-[(3E)-2-(2-methyl-1,2-dihydropyridin-6-yl)-5-prop-1-enylnona-1,3-dien-3-yl]-5-prop-1-en-2-yl-2H-indole (PubChem CID 139419064) has the molecular formula C30H38N2 and a molecular weight of 426.65 g/mol. Its IUPAC name is 2-methyl-3-[(3E)-2-(2-methyl-1,2-dihydropyridin-6-yl)-5-prop-1-enylnona-1,3-dien-3-yl]-5-prop-1-en-2-yl-2H-indole.
| Compound Name | 2-methyl-3-[(3E)-2-(2-methyl-1,2-dihydropyridin-6-yl)-5-prop-1-enylnona-1,3-dien-3-yl]-5-prop-1-en-2-yl-2H-indole |
|---|---|
| PubChem CID | 139419064 |
| Molecular Formula | C30H38N2 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | 2-methyl-3-[(3E)-2-(2-methyl-1,2-dihydropyridin-6-yl)-5-prop-1-enylnona-1,3-dien-3-yl]-5-prop-1-en-2-yl-2H-indole |
| SMILES | C=C(C1=CC=CC(C)N1)/C(=C/C(C=CC)CCCC)C1=c2cc(C(=C)C)ccc2=NC1C |
| InChI | InChI=1S/C30H38N2/c1-8-10-14-24(12-9-2)18-26(22(6)28-15-11-13-21(5)31-28)30-23(7)32-29-17-16-25(20(3)4)19-27(29)30/h9,11-13,15-19,21,23-24,31H,3,6,8,10,14H2,1-2,4-5,7H3/b12-9?,26-18- |
| InChIKey | FKJGXTBZCKTMPN-WGSUEDNDSA-N |
| XLogP | 6.19 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|