C26H29F2N3O2 — CID 139419230
4-[(2S)-2-[[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]amino]butyl]-N-[(2-fluoro-3-pyridinyl)methyl]-N-methylbenzamide (PubChem CID 139419230) has the molecular formula C26H29F2N3O2 and a molecular weight of 453.53 g/mol. Its IUPAC name is 4-[(2S)-2-[[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]amino]butyl]-N-[(2-fluoro-3-pyridinyl)methyl]-N-methylbenzamide.
| Compound Name | 4-[(2S)-2-[[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]amino]butyl]-N-[(2-fluoro-3-pyridinyl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 139419230 |
| Molecular Formula | C26H29F2N3O2 |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 4-[(2S)-2-[[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]amino]butyl]-N-[(2-fluoro-3-pyridinyl)methyl]-N-methylbenzamide |
| SMILES | CC[C@@H](Cc1ccc(C(=O)N(C)Cc2cccnc2F)cc1)NC[C@H](O)c1cccc(F)c1 |
| InChI | InChI=1S/C26H29F2N3O2/c1-3-23(30-16-24(32)20-6-4-8-22(27)15-20)14-18-9-11-19(12-10-18)26(33)31(2)17-21-7-5-13-29-25(21)28/h4-13,15,23-24,30,32H,3,14,16-17H2,1-2H3/t23-,24-/m0/s1 |
| InChIKey | ONVXXVBZUKGUFE-ZEQRLZLVSA-N |
| XLogP | 4.28 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|