About 1-(2-fluoro-3,4-dihydropyridin-3-yl)-N-methylmethanamine
1-(2-fluoro-3,4-dihydropyridin-3-yl)-N-methylmethanamine (PubChem CID 139419293) has the molecular formula C7H11FN2
and a molecular weight of 142.18 g/mol. Its IUPAC name is 1-(2-fluoro-3,4-dihydropyridin-3-yl)-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-(2-fluoro-3,4-dihydropyridin-3-yl)-N-methylmethanamine |
| PubChem CID | 139419293 |
| Molecular Formula | C7H11FN2 |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | 1-(2-fluoro-3,4-dihydropyridin-3-yl)-N-methylmethanamine |
| SMILES | CNCC1CC=CN=C1F |
| InChI | InChI=1S/C7H11FN2/c1-9-5-6-3-2-4-10-7(6)8/h2,4,6,9H,3,5H2,1H3 |
| InChIKey | GRTVWRNXPSSNNT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-fluoro-3,4-dihydropyridin-3-yl)-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluoro-3,4-dihydropyridin-3-yl)-N-methylmethanamine?
The IUPAC name of 1-(2-fluoro-3,4-dihydropyridin-3-yl)-N-methylmethanamine (CID 139419293) is 1-(2-fluoro-3,4-dihydropyridin-3-yl)-N-methylmethanamine.
What is the SMILES notation for 1-(2-fluoro-3,4-dihydropyridin-3-yl)-N-methylmethanamine?
The canonical SMILES for 1-(2-fluoro-3,4-dihydropyridin-3-yl)-N-methylmethanamine is CNCC1CC=CN=C1F.
What is the InChIKey of 1-(2-fluoro-3,4-dihydropyridin-3-yl)-N-methylmethanamine?
The InChIKey is GRTVWRNXPSSNNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11FN2/c1-9-5-6-3-2-4-10-7(6)8/h2,4,6,9H,3,5H2,1H3.
What are the key properties of 1-(2-fluoro-3,4-dihydropyridin-3-yl)-N-methylmethanamine?
1-(2-fluoro-3,4-dihydropyridin-3-yl)-N-methylmethanamine has a molecular weight of 142.18 g/mol, XLogP of 1.11, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluoro-3,4-dihydropyridin-3-yl)-N-methylmethanamine is sourced from PubChem (CID 139419293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).