About N-ethenyl-N-[(1Z,3Z)-penta-1,3-dienyl]methanimidamide
N-ethenyl-N-[(1Z,3Z)-penta-1,3-dienyl]methanimidamide (PubChem CID 139419329) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is N-ethenyl-N-[(1Z,3Z)-penta-1,3-dienyl]methanimidamide.
Molecular Properties
| Compound Name | N-ethenyl-N-[(1Z,3Z)-penta-1,3-dienyl]methanimidamide |
| PubChem CID | 139419329 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | N-ethenyl-N-[(1Z,3Z)-penta-1,3-dienyl]methanimidamide |
| SMILES | [H]/N=C/N(C=C)/C=C\C=C/C |
| InChI | InChI=1S/C8H12N2/c1-3-5-6-7-10(4-2)8-9/h3-9H,2H2,1H3/b5-3-,7-6-,9-8+ |
| InChIKey | WXLVIJWKNXFYRF-BBMAVBMISA-N |
| XLogP | 2.13 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-N-[(1Z,3Z)-penta-1,3-dienyl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N-[(1Z,3Z)-penta-1,3-dienyl]methanimidamide?
The IUPAC name of N-ethenyl-N-[(1Z,3Z)-penta-1,3-dienyl]methanimidamide (CID 139419329) is N-ethenyl-N-[(1Z,3Z)-penta-1,3-dienyl]methanimidamide.
What is the SMILES notation for N-ethenyl-N-[(1Z,3Z)-penta-1,3-dienyl]methanimidamide?
The canonical SMILES for N-ethenyl-N-[(1Z,3Z)-penta-1,3-dienyl]methanimidamide is [H]/N=C/N(C=C)/C=C\C=C/C.
What is the InChIKey of N-ethenyl-N-[(1Z,3Z)-penta-1,3-dienyl]methanimidamide?
The InChIKey is WXLVIJWKNXFYRF-BBMAVBMISA-N. The full InChI is InChI=1S/C8H12N2/c1-3-5-6-7-10(4-2)8-9/h3-9H,2H2,1H3/b5-3-,7-6-,9-8+.
What are the key properties of N-ethenyl-N-[(1Z,3Z)-penta-1,3-dienyl]methanimidamide?
N-ethenyl-N-[(1Z,3Z)-penta-1,3-dienyl]methanimidamide has a molecular weight of 136.20 g/mol, XLogP of 2.13, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N-[(1Z,3Z)-penta-1,3-dienyl]methanimidamide is sourced from PubChem (CID 139419329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).