C21H22F2N4O2 — CID 139419413
2-[[2-[4-(2,2-difluoropropyl)anilino]-3H-benzimidazol-5-yl]oxy]-N-prop-2-enylacetamide (PubChem CID 139419413) has the molecular formula C21H22F2N4O2 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-[[2-[4-(2,2-difluoropropyl)anilino]-3H-benzimidazol-5-yl]oxy]-N-prop-2-enylacetamide.
| Compound Name | 2-[[2-[4-(2,2-difluoropropyl)anilino]-3H-benzimidazol-5-yl]oxy]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 139419413 |
| Molecular Formula | C21H22F2N4O2 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-[[2-[4-(2,2-difluoropropyl)anilino]-3H-benzimidazol-5-yl]oxy]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)COc1ccc2nc(Nc3ccc(CC(C)(F)F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C21H22F2N4O2/c1-3-10-24-19(28)13-29-16-8-9-17-18(11-16)27-20(26-17)25-15-6-4-14(5-7-15)12-21(2,22)23/h3-9,11H,1,10,12-13H2,2H3,(H,24,28)(H2,25,26,27) |
| InChIKey | JFEYAILITCYZAL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|