C17H30N2O2 — CID 139419579
tert-butyl N-(4-imino-3-methylbutan-2-yl)-N-[(1R)-6-methylcyclohex-3-en-1-yl]carbamate (PubChem CID 139419579) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is tert-butyl N-(4-imino-3-methylbutan-2-yl)-N-[(1R)-6-methylcyclohex-3-en-1-yl]carbamate.
| Compound Name | tert-butyl N-(4-imino-3-methylbutan-2-yl)-N-[(1R)-6-methylcyclohex-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 139419579 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | tert-butyl N-(4-imino-3-methylbutan-2-yl)-N-[(1R)-6-methylcyclohex-3-en-1-yl]carbamate |
| SMILES | [H]/N=C/C(C)C(C)N(C(=O)OC(C)(C)C)[C@@H]1CC=CCC1C |
| InChI | InChI=1S/C17H30N2O2/c1-12-9-7-8-10-15(12)19(14(3)13(2)11-18)16(20)21-17(4,5)6/h7-8,11-15,18H,9-10H2,1-6H3/b18-11+/t12?,13?,14?,15-/m1/s1 |
| InChIKey | PTTGDDASXQNOPY-NPNFEWRHSA-N |
| XLogP | 4.25 |
| TPSA | 53.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|