C27H30F3N3O2 — CID 139419652
methyl (E)-3-[2-[4-(trifluoromethyl)anilino]-1-[(5R)-3,3,5-trimethylcyclohexyl]benzimidazol-5-yl]prop-2-enoate (PubChem CID 139419652) has the molecular formula C27H30F3N3O2 and a molecular weight of 485.55 g/mol. Its IUPAC name is methyl (E)-3-[2-[4-(trifluoromethyl)anilino]-1-[(5R)-3,3,5-trimethylcyclohexyl]benzimidazol-5-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-[4-(trifluoromethyl)anilino]-1-[(5R)-3,3,5-trimethylcyclohexyl]benzimidazol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 139419652 |
| Molecular Formula | C27H30F3N3O2 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | methyl (E)-3-[2-[4-(trifluoromethyl)anilino]-1-[(5R)-3,3,5-trimethylcyclohexyl]benzimidazol-5-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc2c(c1)nc(Nc1ccc(C(F)(F)F)cc1)n2C1C[C@H](C)CC(C)(C)C1 |
| InChI | InChI=1S/C27H30F3N3O2/c1-17-13-21(16-26(2,3)15-17)33-23-11-5-18(6-12-24(34)35-4)14-22(23)32-25(33)31-20-9-7-19(8-10-20)27(28,29)30/h5-12,14,17,21H,13,15-16H2,1-4H3,(H,31,32)/b12-6+/t17-,21?/m0/s1 |
| InChIKey | XHSKBCBUQNRTES-VUIOXFFPSA-N |
| XLogP | 7.37 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|