About (5E)-N-butyl-7-methoxy-N-methyl-4-methylideneocta-5,7-dien-1-amine
(5E)-N-butyl-7-methoxy-N-methyl-4-methylideneocta-5,7-dien-1-amine (PubChem CID 139419803) has the molecular formula C15H27NO
and a molecular weight of 237.39 g/mol. Its IUPAC name is (5E)-N-butyl-7-methoxy-N-methyl-4-methylideneocta-5,7-dien-1-amine.
Molecular Properties
| Compound Name | (5E)-N-butyl-7-methoxy-N-methyl-4-methylideneocta-5,7-dien-1-amine |
| PubChem CID | 139419803 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (5E)-N-butyl-7-methoxy-N-methyl-4-methylideneocta-5,7-dien-1-amine |
| SMILES | C=C(/C=C/C(=C)OC)CCCN(C)CCCC |
| InChI | InChI=1S/C15H27NO/c1-6-7-12-16(4)13-8-9-14(2)10-11-15(3)17-5/h10-11H,2-3,6-9,12-13H2,1,4-5H3/b11-10+ |
| InChIKey | VOROEQJYHYOYDX-ZHACJKMWSA-N |
| XLogP | 3.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-N-butyl-7-methoxy-N-methyl-4-methylideneocta-5,7-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-N-butyl-7-methoxy-N-methyl-4-methylideneocta-5,7-dien-1-amine?
The IUPAC name of (5E)-N-butyl-7-methoxy-N-methyl-4-methylideneocta-5,7-dien-1-amine (CID 139419803) is (5E)-N-butyl-7-methoxy-N-methyl-4-methylideneocta-5,7-dien-1-amine.
What is the SMILES notation for (5E)-N-butyl-7-methoxy-N-methyl-4-methylideneocta-5,7-dien-1-amine?
The canonical SMILES for (5E)-N-butyl-7-methoxy-N-methyl-4-methylideneocta-5,7-dien-1-amine is C=C(/C=C/C(=C)OC)CCCN(C)CCCC.
What is the InChIKey of (5E)-N-butyl-7-methoxy-N-methyl-4-methylideneocta-5,7-dien-1-amine?
The InChIKey is VOROEQJYHYOYDX-ZHACJKMWSA-N. The full InChI is InChI=1S/C15H27NO/c1-6-7-12-16(4)13-8-9-14(2)10-11-15(3)17-5/h10-11H,2-3,6-9,12-13H2,1,4-5H3/b11-10+.
What are the key properties of (5E)-N-butyl-7-methoxy-N-methyl-4-methylideneocta-5,7-dien-1-amine?
(5E)-N-butyl-7-methoxy-N-methyl-4-methylideneocta-5,7-dien-1-amine has a molecular weight of 237.39 g/mol, XLogP of 3.77, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-N-butyl-7-methoxy-N-methyl-4-methylideneocta-5,7-dien-1-amine is sourced from PubChem (CID 139419803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).