About 5-(cyclohexylmethyl)-7-piperidin-1-yl-2,3-dihydroquinoxaline
5-(cyclohexylmethyl)-7-piperidin-1-yl-2,3-dihydroquinoxaline (PubChem CID 139419955) has the molecular formula C20H29N3
and a molecular weight of 311.47 g/mol. Its IUPAC name is 5-(cyclohexylmethyl)-7-piperidin-1-yl-2,3-dihydroquinoxaline.
Molecular Properties
| Compound Name | 5-(cyclohexylmethyl)-7-piperidin-1-yl-2,3-dihydroquinoxaline |
| PubChem CID | 139419955 |
| Molecular Formula | C20H29N3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | 5-(cyclohexylmethyl)-7-piperidin-1-yl-2,3-dihydroquinoxaline |
| SMILES | c1c(N2CCCCC2)cc2c(c1CC1CCCCC1)=NCCN=2 |
| InChI | InChI=1S/C20H29N3/c1-3-7-16(8-4-1)13-17-14-18(23-11-5-2-6-12-23)15-19-20(17)22-10-9-21-19/h14-16H,1-13H2 |
| InChIKey | MCZNYVRIIXVCSG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(cyclohexylmethyl)-7-piperidin-1-yl-2,3-dihydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cyclohexylmethyl)-7-piperidin-1-yl-2,3-dihydroquinoxaline?
The IUPAC name of 5-(cyclohexylmethyl)-7-piperidin-1-yl-2,3-dihydroquinoxaline (CID 139419955) is 5-(cyclohexylmethyl)-7-piperidin-1-yl-2,3-dihydroquinoxaline.
What is the SMILES notation for 5-(cyclohexylmethyl)-7-piperidin-1-yl-2,3-dihydroquinoxaline?
The canonical SMILES for 5-(cyclohexylmethyl)-7-piperidin-1-yl-2,3-dihydroquinoxaline is c1c(N2CCCCC2)cc2c(c1CC1CCCCC1)=NCCN=2.
What is the InChIKey of 5-(cyclohexylmethyl)-7-piperidin-1-yl-2,3-dihydroquinoxaline?
The InChIKey is MCZNYVRIIXVCSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29N3/c1-3-7-16(8-4-1)13-17-14-18(23-11-5-2-6-12-23)15-19-20(17)22-10-9-21-19/h14-16H,1-13H2.
What are the key properties of 5-(cyclohexylmethyl)-7-piperidin-1-yl-2,3-dihydroquinoxaline?
5-(cyclohexylmethyl)-7-piperidin-1-yl-2,3-dihydroquinoxaline has a molecular weight of 311.47 g/mol, XLogP of 3.05, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyclohexylmethyl)-7-piperidin-1-yl-2,3-dihydroquinoxaline is sourced from PubChem (CID 139419955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).