C25H40N4 — CID 139420046
1-[(6-ethylimino-5-methylidene-3-piperidin-1-ylcyclohexa-1,3-dien-1-yl)methyl]-N-[(Z)-pent-3-en-2-yl]piperidin-4-amine (PubChem CID 139420046) has the molecular formula C25H40N4 and a molecular weight of 396.62 g/mol. Its IUPAC name is 1-[(6-ethylimino-5-methylidene-3-piperidin-1-ylcyclohexa-1,3-dien-1-yl)methyl]-N-[(Z)-pent-3-en-2-yl]piperidin-4-amine.
| Compound Name | 1-[(6-ethylimino-5-methylidene-3-piperidin-1-ylcyclohexa-1,3-dien-1-yl)methyl]-N-[(Z)-pent-3-en-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 139420046 |
| Molecular Formula | C25H40N4 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.33 |
| IUPAC Name | 1-[(6-ethylimino-5-methylidene-3-piperidin-1-ylcyclohexa-1,3-dien-1-yl)methyl]-N-[(Z)-pent-3-en-2-yl]piperidin-4-amine |
| SMILES | C=C1C=C(N2CCCCC2)C=C(CN2CCC(NC(C)/C=C\C)CC2)/C1=N/CC |
| InChI | InChI=1S/C25H40N4/c1-5-10-21(4)27-23-11-15-28(16-12-23)19-22-18-24(29-13-8-7-9-14-29)17-20(3)25(22)26-6-2/h5,10,17-18,21,23,27H,3,6-9,11-16,19H2,1-2,4H3/b10-5-,26-25+ |
| InChIKey | NCSZDYOWMZCIQD-VQBIBGSTSA-N |
| XLogP | 4.33 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|