C17H25NO — CID 139420413
4-(1-ethylcyclopropyl)-N,3-dimethyl-N-propylbenzamide (PubChem CID 139420413) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 4-(1-ethylcyclopropyl)-N,3-dimethyl-N-propylbenzamide.
| Compound Name | 4-(1-ethylcyclopropyl)-N,3-dimethyl-N-propylbenzamide |
|---|---|
| PubChem CID | 139420413 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 4-(1-ethylcyclopropyl)-N,3-dimethyl-N-propylbenzamide |
| SMILES | CCCN(C)C(=O)c1ccc(C2(CC)CC2)c(C)c1 |
| InChI | InChI=1S/C17H25NO/c1-5-11-18(4)16(19)14-7-8-15(13(3)12-14)17(6-2)9-10-17/h7-8,12H,5-6,9-11H2,1-4H3 |
| InChIKey | UIAXBQZQKMOWEQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |