C17H17F2NO — CID 139420659
(3aR,4S,9bR)-8-fluoro-4-(3-fluorophenyl)-2,3,3a,4,5,8,9,9b-octahydrofuro[3,2-c]quinoline (PubChem CID 139420659) has the molecular formula C17H17F2NO and a molecular weight of 289.32 g/mol. Its IUPAC name is (3aR,4S,9bR)-8-fluoro-4-(3-fluorophenyl)-2,3,3a,4,5,8,9,9b-octahydrofuro[3,2-c]quinoline.
| Compound Name | (3aR,4S,9bR)-8-fluoro-4-(3-fluorophenyl)-2,3,3a,4,5,8,9,9b-octahydrofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 139420659 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (3aR,4S,9bR)-8-fluoro-4-(3-fluorophenyl)-2,3,3a,4,5,8,9,9b-octahydrofuro[3,2-c]quinoline |
| SMILES | Fc1cccc([C@H]2NC3=C(CC(F)C=C3)[C@@H]3OCC[C@H]23)c1 |
| InChI | InChI=1S/C17H17F2NO/c18-11-3-1-2-10(8-11)16-13-6-7-21-17(13)14-9-12(19)4-5-15(14)20-16/h1-5,8,12-13,16-17,20H,6-7,9H2/t12?,13-,16-,17-/m1/s1 |
| InChIKey | YUQDVTXGVLVWAU-BQZPIORYSA-N |
| XLogP | 3.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |