About (1Z,3Z)-5-methyl-4-(methyliminomethyl)hexa-1,3-dien-1-amine
(1Z,3Z)-5-methyl-4-(methyliminomethyl)hexa-1,3-dien-1-amine (PubChem CID 139420743) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is (1Z,3Z)-5-methyl-4-(methyliminomethyl)hexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1Z,3Z)-5-methyl-4-(methyliminomethyl)hexa-1,3-dien-1-amine |
| PubChem CID | 139420743 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (1Z,3Z)-5-methyl-4-(methyliminomethyl)hexa-1,3-dien-1-amine |
| SMILES | C/N=C/C(=C\C=C/N)C(C)C |
| InChI | InChI=1S/C9H16N2/c1-8(2)9(7-11-3)5-4-6-10/h4-8H,10H2,1-3H3/b6-4-,9-5+,11-7+ |
| InChIKey | IUDPWCNURPNVOV-ZHTAQXPLSA-N |
| XLogP | 1.74 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3Z)-5-methyl-4-(methyliminomethyl)hexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3Z)-5-methyl-4-(methyliminomethyl)hexa-1,3-dien-1-amine?
The IUPAC name of (1Z,3Z)-5-methyl-4-(methyliminomethyl)hexa-1,3-dien-1-amine (CID 139420743) is (1Z,3Z)-5-methyl-4-(methyliminomethyl)hexa-1,3-dien-1-amine.
What is the SMILES notation for (1Z,3Z)-5-methyl-4-(methyliminomethyl)hexa-1,3-dien-1-amine?
The canonical SMILES for (1Z,3Z)-5-methyl-4-(methyliminomethyl)hexa-1,3-dien-1-amine is C/N=C/C(=C\C=C/N)C(C)C.
What is the InChIKey of (1Z,3Z)-5-methyl-4-(methyliminomethyl)hexa-1,3-dien-1-amine?
The InChIKey is IUDPWCNURPNVOV-ZHTAQXPLSA-N. The full InChI is InChI=1S/C9H16N2/c1-8(2)9(7-11-3)5-4-6-10/h4-8H,10H2,1-3H3/b6-4-,9-5+,11-7+.
What are the key properties of (1Z,3Z)-5-methyl-4-(methyliminomethyl)hexa-1,3-dien-1-amine?
(1Z,3Z)-5-methyl-4-(methyliminomethyl)hexa-1,3-dien-1-amine has a molecular weight of 152.24 g/mol, XLogP of 1.74, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3Z)-5-methyl-4-(methyliminomethyl)hexa-1,3-dien-1-amine is sourced from PubChem (CID 139420743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).