C15H18N4O5 — CID 139421285
2-[4-methyl-3-[(5-methyl-4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]phenoxy]ethyl acetate (PubChem CID 139421285) has the molecular formula C15H18N4O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is 2-[4-methyl-3-[(5-methyl-4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]phenoxy]ethyl acetate.
| Compound Name | 2-[4-methyl-3-[(5-methyl-4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]phenoxy]ethyl acetate |
|---|---|
| PubChem CID | 139421285 |
| Molecular Formula | C15H18N4O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-[4-methyl-3-[(5-methyl-4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]phenoxy]ethyl acetate |
| SMILES | CC(=O)OCCOc1ccc(C)c(Nc2nc(=O)n(C)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C15H18N4O5/c1-9-4-5-11(24-7-6-23-10(2)20)8-12(9)16-13-17-14(21)19(3)15(22)18-13/h4-5,8H,6-7H2,1-3H3,(H2,16,17,18,21,22) |
| InChIKey | PKYDMHVIFLTMBF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|