C20H18F3N5O3 — CID 139421395
4-(4,5-dimethoxy-2-methylanilino)-6-(3,4,5-trifluorophenyl)-7,8-dihydro-6H-imidazo[1,2-a][1,3,5]triazin-2-one (PubChem CID 139421395) has the molecular formula C20H18F3N5O3 and a molecular weight of 433.39 g/mol. Its IUPAC name is 4-(4,5-dimethoxy-2-methylanilino)-6-(3,4,5-trifluorophenyl)-7,8-dihydro-6H-imidazo[1,2-a][1,3,5]triazin-2-one.
| Compound Name | 4-(4,5-dimethoxy-2-methylanilino)-6-(3,4,5-trifluorophenyl)-7,8-dihydro-6H-imidazo[1,2-a][1,3,5]triazin-2-one |
|---|---|
| PubChem CID | 139421395 |
| Molecular Formula | C20H18F3N5O3 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 4-(4,5-dimethoxy-2-methylanilino)-6-(3,4,5-trifluorophenyl)-7,8-dihydro-6H-imidazo[1,2-a][1,3,5]triazin-2-one |
| SMILES | COc1cc(C)c(Nc2nc(=O)nc3n2C(c2cc(F)c(F)c(F)c2)CN3)cc1OC |
| InChI | InChI=1S/C20H18F3N5O3/c1-9-4-15(30-2)16(31-3)7-13(9)25-19-27-20(29)26-18-24-8-14(28(18)19)10-5-11(21)17(23)12(22)6-10/h4-7,14H,8H2,1-3H3,(H2,24,25,26,27,29) |
| InChIKey | FSLBUTNANKUWQA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|