C21H23N5O — CID 139421404
6-benzyl-4-(2,5-dimethylphenyl)imino-1-methyl-6,7-dihydroimidazo[1,2-a][1,3,5]triazin-2-one (PubChem CID 139421404) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is 6-benzyl-4-(2,5-dimethylphenyl)imino-1-methyl-6,7-dihydroimidazo[1,2-a][1,3,5]triazin-2-one.
| Compound Name | 6-benzyl-4-(2,5-dimethylphenyl)imino-1-methyl-6,7-dihydroimidazo[1,2-a][1,3,5]triazin-2-one |
|---|---|
| PubChem CID | 139421404 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 6-benzyl-4-(2,5-dimethylphenyl)imino-1-methyl-6,7-dihydroimidazo[1,2-a][1,3,5]triazin-2-one |
| SMILES | Cc1ccc(C)c(/N=C2\NC(=O)N(C)C3=NCC(Cc4ccccc4)N32)c1 |
| InChI | InChI=1S/C21H23N5O/c1-14-9-10-15(2)18(11-14)23-19-24-21(27)25(3)20-22-13-17(26(19)20)12-16-7-5-4-6-8-16/h4-11,17H,12-13H2,1-3H3,(H,23,24,27) |
| InChIKey | ONBKXHMAXOWOSZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 60.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|