About (3-methylsulfanylphenyl) N-[(1E)-2,3-dimethylbuta-1,3-dienyl]ethanimidothioate
(3-methylsulfanylphenyl) N-[(1E)-2,3-dimethylbuta-1,3-dienyl]ethanimidothioate (PubChem CID 139421449) has the molecular formula C15H19NS2
and a molecular weight of 277.46 g/mol. Its IUPAC name is (3-methylsulfanylphenyl) N-[(1E)-2,3-dimethylbuta-1,3-dienyl]ethanimidothioate.
Molecular Properties
| Compound Name | (3-methylsulfanylphenyl) N-[(1E)-2,3-dimethylbuta-1,3-dienyl]ethanimidothioate |
| PubChem CID | 139421449 |
| Molecular Formula | C15H19NS2 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (3-methylsulfanylphenyl) N-[(1E)-2,3-dimethylbuta-1,3-dienyl]ethanimidothioate |
| SMILES | C=C(C)/C(C)=C/N=C(\C)Sc1cccc(SC)c1 |
| InChI | InChI=1S/C15H19NS2/c1-11(2)12(3)10-16-13(4)18-15-8-6-7-14(9-15)17-5/h6-10H,1H2,2-5H3/b12-10+,16-13+ |
| InChIKey | DIOKLISSVSGSOE-XBKMVRDJSA-N |
| XLogP | 5.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3-methylsulfanylphenyl) N-[(1E)-2,3-dimethylbuta-1,3-dienyl]ethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylsulfanylphenyl) N-[(1E)-2,3-dimethylbuta-1,3-dienyl]ethanimidothioate?
The IUPAC name of (3-methylsulfanylphenyl) N-[(1E)-2,3-dimethylbuta-1,3-dienyl]ethanimidothioate (CID 139421449) is (3-methylsulfanylphenyl) N-[(1E)-2,3-dimethylbuta-1,3-dienyl]ethanimidothioate.
What is the SMILES notation for (3-methylsulfanylphenyl) N-[(1E)-2,3-dimethylbuta-1,3-dienyl]ethanimidothioate?
The canonical SMILES for (3-methylsulfanylphenyl) N-[(1E)-2,3-dimethylbuta-1,3-dienyl]ethanimidothioate is C=C(C)/C(C)=C/N=C(\C)Sc1cccc(SC)c1.
What is the InChIKey of (3-methylsulfanylphenyl) N-[(1E)-2,3-dimethylbuta-1,3-dienyl]ethanimidothioate?
The InChIKey is DIOKLISSVSGSOE-XBKMVRDJSA-N. The full InChI is InChI=1S/C15H19NS2/c1-11(2)12(3)10-16-13(4)18-15-8-6-7-14(9-15)17-5/h6-10H,1H2,2-5H3/b12-10+,16-13+.
What are the key properties of (3-methylsulfanylphenyl) N-[(1E)-2,3-dimethylbuta-1,3-dienyl]ethanimidothioate?
(3-methylsulfanylphenyl) N-[(1E)-2,3-dimethylbuta-1,3-dienyl]ethanimidothioate has a molecular weight of 277.46 g/mol, XLogP of 5.40, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylsulfanylphenyl) N-[(1E)-2,3-dimethylbuta-1,3-dienyl]ethanimidothioate is sourced from PubChem (CID 139421449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).