C19H18F2N6O — CID 139421740
6-(3,5-difluorophenyl)-4-[(2,6-dimethyl-3-pyridinyl)imino]-1-methyl-6,7-dihydroimidazo[1,2-a][1,3,5]triazin-2-one (PubChem CID 139421740) has the molecular formula C19H18F2N6O and a molecular weight of 384.39 g/mol. Its IUPAC name is 6-(3,5-difluorophenyl)-4-[(2,6-dimethyl-3-pyridinyl)imino]-1-methyl-6,7-dihydroimidazo[1,2-a][1,3,5]triazin-2-one.
| Compound Name | 6-(3,5-difluorophenyl)-4-[(2,6-dimethyl-3-pyridinyl)imino]-1-methyl-6,7-dihydroimidazo[1,2-a][1,3,5]triazin-2-one |
|---|---|
| PubChem CID | 139421740 |
| Molecular Formula | C19H18F2N6O |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 6-(3,5-difluorophenyl)-4-[(2,6-dimethyl-3-pyridinyl)imino]-1-methyl-6,7-dihydroimidazo[1,2-a][1,3,5]triazin-2-one |
| SMILES | Cc1ccc(/N=C2\NC(=O)N(C)C3=NCC(c4cc(F)cc(F)c4)N32)c(C)n1 |
| InChI | InChI=1S/C19H18F2N6O/c1-10-4-5-15(11(2)23-10)24-17-25-19(28)26(3)18-22-9-16(27(17)18)12-6-13(20)8-14(21)7-12/h4-8,16H,9H2,1-3H3,(H,24,25,28) |
| InChIKey | VUMBARCLAHMACD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 73.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|