C26H31FN4O10 — CID 139421943
3-[[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]-dihydroxymethyl]amino]-2-[[methyl-(4,4,5,5-tetrahydroxy-2,6-dioxopiperidin-3-yl)amino]methyl]benzaldehyde (PubChem CID 139421943) has the molecular formula C26H31FN4O10 and a molecular weight of 578.55 g/mol. Its IUPAC name is 3-[[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]-dihydroxymethyl]amino]-2-[[methyl-(4,4,5,5-tetrahydroxy-2,6-dioxopiperidin-3-yl)amino]methyl]benzaldehyde.
| Compound Name | 3-[[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]-dihydroxymethyl]amino]-2-[[methyl-(4,4,5,5-tetrahydroxy-2,6-dioxopiperidin-3-yl)amino]methyl]benzaldehyde |
|---|---|
| PubChem CID | 139421943 |
| Molecular Formula | C26H31FN4O10 |
| Molecular Weight | 578.55 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | 3-[[[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]-dihydroxymethyl]amino]-2-[[methyl-(4,4,5,5-tetrahydroxy-2,6-dioxopiperidin-3-yl)amino]methyl]benzaldehyde |
| SMILES | CN(Cc1c(C=O)cccc1NC(O)(O)c1ccc(CN2CCOCC2)cc1F)C1C(=O)NC(=O)C(O)(O)C1(O)O |
| InChI | InChI=1S/C26H31FN4O10/c1-30(21-22(33)28-23(34)25(37,38)24(21,35)36)13-17-16(14-32)3-2-4-20(17)29-26(39,40)18-6-5-15(11-19(18)27)12-31-7-9-41-10-8-31/h2-6,11,14,21,29,35-40H,7-10,12-13H2,1H3,(H,28,33,34) |
| InChIKey | HOEQDYQBTAALLI-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 212.36 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.55 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|