C16H20IN3O2 — CID 139422096
tert-butyl (3S)-3-(6-iodopyrrolo[2,3-b]pyridin-1-yl)pyrrolidine-1-carboxylate (PubChem CID 139422096) has the molecular formula C16H20IN3O2 and a molecular weight of 413.26 g/mol. Its IUPAC name is tert-butyl (3S)-3-(6-iodopyrrolo[2,3-b]pyridin-1-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(6-iodopyrrolo[2,3-b]pyridin-1-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139422096 |
| Molecular Formula | C16H20IN3O2 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | tert-butyl (3S)-3-(6-iodopyrrolo[2,3-b]pyridin-1-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](n2ccc3ccc(I)nc32)C1 |
| InChI | InChI=1S/C16H20IN3O2/c1-16(2,3)22-15(21)19-8-7-12(10-19)20-9-6-11-4-5-13(17)18-14(11)20/h4-6,9,12H,7-8,10H2,1-3H3/t12-/m0/s1 |
| InChIKey | UXIMQHJEKZVPLE-LBPRGKRZSA-N |
| XLogP | 3.82 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|