C9H17N3O3S — CID 139423450
6-hydroxy-1,3-di(propan-2-yl)-5-sulfanyl-1,3,5-triazinane-2,4-dione (PubChem CID 139423450) has the molecular formula C9H17N3O3S and a molecular weight of 247.32 g/mol. Its IUPAC name is 6-hydroxy-1,3-di(propan-2-yl)-5-sulfanyl-1,3,5-triazinane-2,4-dione.
| Compound Name | 6-hydroxy-1,3-di(propan-2-yl)-5-sulfanyl-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 139423450 |
| Molecular Formula | C9H17N3O3S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 6-hydroxy-1,3-di(propan-2-yl)-5-sulfanyl-1,3,5-triazinane-2,4-dione |
| SMILES | CC(C)N1C(=O)N(S)C(O)N(C(C)C)C1=O |
| InChI | InChI=1S/C9H17N3O3S/c1-5(2)10-7(13)11(6(3)4)9(15)12(16)8(10)14/h5-6,8,14,16H,1-4H3 |
| InChIKey | LOPIRJVQVAZMGW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|