C21H38N2 — CID 139423545
(1S,9Z)-5-[(3S)-5,5-dimethylpyrrolidin-3-yl]-1,10,13-trimethyl-5-azabicyclo[10.1.0]tridec-9-ene (PubChem CID 139423545) has the molecular formula C21H38N2 and a molecular weight of 318.55 g/mol. Its IUPAC name is (1S,9Z)-5-[(3S)-5,5-dimethylpyrrolidin-3-yl]-1,10,13-trimethyl-5-azabicyclo[10.1.0]tridec-9-ene.
| Compound Name | (1S,9Z)-5-[(3S)-5,5-dimethylpyrrolidin-3-yl]-1,10,13-trimethyl-5-azabicyclo[10.1.0]tridec-9-ene |
|---|---|
| PubChem CID | 139423545 |
| Molecular Formula | C21H38N2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.30 |
| IUPAC Name | (1S,9Z)-5-[(3S)-5,5-dimethylpyrrolidin-3-yl]-1,10,13-trimethyl-5-azabicyclo[10.1.0]tridec-9-ene |
| SMILES | C/C1=C/CCCN([C@@H]2CNC(C)(C)C2)CCC[C@@]2(C)C(C)C2C1 |
| InChI | InChI=1S/C21H38N2/c1-16-9-6-7-11-23(18-14-20(3,4)22-15-18)12-8-10-21(5)17(2)19(21)13-16/h9,17-19,22H,6-8,10-15H2,1-5H3/b16-9-/t17?,18-,19?,21-/m0/s1 |
| InChIKey | NSYVNFWPVNURCC-WVHHQYHGSA-N |
| XLogP | 4.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|