C15H31FN2 — CID 139423571
(Z,3R,5S,9R)-3-ethyl-5-fluoro-1-N,3,5-trimethyldec-7-ene-1,9-diamine (PubChem CID 139423571) has the molecular formula C15H31FN2 and a molecular weight of 258.42 g/mol. Its IUPAC name is (Z,3R,5S,9R)-3-ethyl-5-fluoro-1-N,3,5-trimethyldec-7-ene-1,9-diamine.
| Compound Name | (Z,3R,5S,9R)-3-ethyl-5-fluoro-1-N,3,5-trimethyldec-7-ene-1,9-diamine |
|---|---|
| PubChem CID | 139423571 |
| Molecular Formula | C15H31FN2 |
| Molecular Weight | 258.42 g/mol |
| Exact Mass | 258.25 |
| IUPAC Name | (Z,3R,5S,9R)-3-ethyl-5-fluoro-1-N,3,5-trimethyldec-7-ene-1,9-diamine |
| SMILES | CC[C@](C)(CCNC)C[C@@](C)(F)C/C=C\[C@@H](C)N |
| InChI | InChI=1S/C15H31FN2/c1-6-14(3,10-11-18-5)12-15(4,16)9-7-8-13(2)17/h7-8,13,18H,6,9-12,17H2,1-5H3/b8-7-/t13-,14-,15+/m1/s1 |
| InChIKey | CTWMEUFPWPRHBQ-ODDKPAMPSA-N |
| XLogP | 3.42 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|