About 5'-(4-pyridin-2-yltriazol-1-yl)spiro[1H-indole-3,3'-oxane]-2-one
5'-(4-pyridin-2-yltriazol-1-yl)spiro[1H-indole-3,3'-oxane]-2-one (PubChem CID 139424043) has the molecular formula C19H17N5O2
and a molecular weight of 347.38 g/mol. Its IUPAC name is 5'-(4-pyridin-2-yltriazol-1-yl)spiro[1H-indole-3,3'-oxane]-2-one.
Molecular Properties
| Compound Name | 5'-(4-pyridin-2-yltriazol-1-yl)spiro[1H-indole-3,3'-oxane]-2-one |
| PubChem CID | 139424043 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 5'-(4-pyridin-2-yltriazol-1-yl)spiro[1H-indole-3,3'-oxane]-2-one |
| SMILES | O=C1Nc2ccccc2C12COCC(n1cc(-c3ccccn3)nn1)C2 |
| InChI | InChI=1S/C19H17N5O2/c25-18-19(14-5-1-2-6-15(14)21-18)9-13(11-26-12-19)24-10-17(22-23-24)16-7-3-4-8-20-16/h1-8,10,13H,9,11-12H2,(H,21,25) |
| InChIKey | FZELANLRDYTKFI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5'-(4-pyridin-2-yltriazol-1-yl)spiro[1H-indole-3,3'-oxane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5'-(4-pyridin-2-yltriazol-1-yl)spiro[1H-indole-3,3'-oxane]-2-one?
The IUPAC name of 5'-(4-pyridin-2-yltriazol-1-yl)spiro[1H-indole-3,3'-oxane]-2-one (CID 139424043) is 5'-(4-pyridin-2-yltriazol-1-yl)spiro[1H-indole-3,3'-oxane]-2-one.
What is the SMILES notation for 5'-(4-pyridin-2-yltriazol-1-yl)spiro[1H-indole-3,3'-oxane]-2-one?
The canonical SMILES for 5'-(4-pyridin-2-yltriazol-1-yl)spiro[1H-indole-3,3'-oxane]-2-one is O=C1Nc2ccccc2C12COCC(n1cc(-c3ccccn3)nn1)C2.
What is the InChIKey of 5'-(4-pyridin-2-yltriazol-1-yl)spiro[1H-indole-3,3'-oxane]-2-one?
The InChIKey is FZELANLRDYTKFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5O2/c25-18-19(14-5-1-2-6-15(14)21-18)9-13(11-26-12-19)24-10-17(22-23-24)16-7-3-4-8-20-16/h1-8,10,13H,9,11-12H2,(H,21,25).
What are the key properties of 5'-(4-pyridin-2-yltriazol-1-yl)spiro[1H-indole-3,3'-oxane]-2-one?
5'-(4-pyridin-2-yltriazol-1-yl)spiro[1H-indole-3,3'-oxane]-2-one has a molecular weight of 347.38 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5'-(4-pyridin-2-yltriazol-1-yl)spiro[1H-indole-3,3'-oxane]-2-one is sourced from PubChem (CID 139424043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).