C39H52N4O8 — CID 139424181
N-(2-amino-2-oxoethyl)-5-[3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]-4-methylphenyl]-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide (PubChem CID 139424181) has the molecular formula C39H52N4O8 and a molecular weight of 704.86 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-5-[3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]-4-methylphenyl]-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide.
| Compound Name | N-(2-amino-2-oxoethyl)-5-[3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]-4-methylphenyl]-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide |
|---|---|
| PubChem CID | 139424181 |
| Molecular Formula | C39H52N4O8 |
| Molecular Weight | 704.86 g/mol |
| Exact Mass | 704.38 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-5-[3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]-4-methylphenyl]-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide |
| SMILES | Cc1ccc(C(C)CCCC(=O)N(CC(N)=O)CC(O)C(O)C(O)C(O)CO)cc1CNC1(c2cnccc2-c2ccccc2OC2CC2)CC1 |
| InChI | InChI=1S/C39H52N4O8/c1-24(6-5-9-36(48)43(22-35(40)47)21-32(45)37(49)38(50)33(46)23-44)26-11-10-25(2)27(18-26)19-42-39(15-16-39)31-20-41-17-14-29(31)30-7-3-4-8-34(30)51-28-12-13-28/h3-4,7-8,10-11,14,17-18,20,24,28,32-33,37-38,42,44-46,49-50H,5-6,9,12-13,15-16,19,21-23H2,1-2H3,(H2,40,47) |
| InChIKey | WPEUDZXSFLFWJJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 198.70 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.86 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |