About 5-[3-(2,2-difluoroethyl)piperazin-1-yl]-4-methoxypyridin-2-amine
5-[3-(2,2-difluoroethyl)piperazin-1-yl]-4-methoxypyridin-2-amine (PubChem CID 139424789) has the molecular formula C12H18F2N4O
and a molecular weight of 272.30 g/mol. Its IUPAC name is 5-[3-(2,2-difluoroethyl)piperazin-1-yl]-4-methoxypyridin-2-amine.
Molecular Properties
| Compound Name | 5-[3-(2,2-difluoroethyl)piperazin-1-yl]-4-methoxypyridin-2-amine |
| PubChem CID | 139424789 |
| Molecular Formula | C12H18F2N4O |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 5-[3-(2,2-difluoroethyl)piperazin-1-yl]-4-methoxypyridin-2-amine |
| SMILES | COc1cc(N)ncc1N1CCNC(CC(F)F)C1 |
| InChI | InChI=1S/C12H18F2N4O/c1-19-10-5-12(15)17-6-9(10)18-3-2-16-8(7-18)4-11(13)14/h5-6,8,11,16H,2-4,7H2,1H3,(H2,15,17) |
| InChIKey | ABUOSDCALJMEFP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[3-(2,2-difluoroethyl)piperazin-1-yl]-4-methoxypyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(2,2-difluoroethyl)piperazin-1-yl]-4-methoxypyridin-2-amine?
The IUPAC name of 5-[3-(2,2-difluoroethyl)piperazin-1-yl]-4-methoxypyridin-2-amine (CID 139424789) is 5-[3-(2,2-difluoroethyl)piperazin-1-yl]-4-methoxypyridin-2-amine.
What is the SMILES notation for 5-[3-(2,2-difluoroethyl)piperazin-1-yl]-4-methoxypyridin-2-amine?
The canonical SMILES for 5-[3-(2,2-difluoroethyl)piperazin-1-yl]-4-methoxypyridin-2-amine is COc1cc(N)ncc1N1CCNC(CC(F)F)C1.
What is the InChIKey of 5-[3-(2,2-difluoroethyl)piperazin-1-yl]-4-methoxypyridin-2-amine?
The InChIKey is ABUOSDCALJMEFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2N4O/c1-19-10-5-12(15)17-6-9(10)18-3-2-16-8(7-18)4-11(13)14/h5-6,8,11,16H,2-4,7H2,1H3,(H2,15,17).
What are the key properties of 5-[3-(2,2-difluoroethyl)piperazin-1-yl]-4-methoxypyridin-2-amine?
5-[3-(2,2-difluoroethyl)piperazin-1-yl]-4-methoxypyridin-2-amine has a molecular weight of 272.30 g/mol, XLogP of 1.11, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(2,2-difluoroethyl)piperazin-1-yl]-4-methoxypyridin-2-amine is sourced from PubChem (CID 139424789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).