C19H26F2N2O9 — CID 139424882
9-[2-(2,5-difluorophenyl)-1,1-dihydroxyethyl]-2-methyl-4-(1,1,2,2,2-pentahydroxyethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (PubChem CID 139424882) has the molecular formula C19H26F2N2O9 and a molecular weight of 464.42 g/mol. Its IUPAC name is 9-[2-(2,5-difluorophenyl)-1,1-dihydroxyethyl]-2-methyl-4-(1,1,2,2,2-pentahydroxyethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 9-[2-(2,5-difluorophenyl)-1,1-dihydroxyethyl]-2-methyl-4-(1,1,2,2,2-pentahydroxyethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 139424882 |
| Molecular Formula | C19H26F2N2O9 |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 9-[2-(2,5-difluorophenyl)-1,1-dihydroxyethyl]-2-methyl-4-(1,1,2,2,2-pentahydroxyethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| SMILES | CC1OC2(CCN(C(O)(O)Cc3cc(F)ccc3F)CC2)CN(C(O)(O)C(O)(O)O)C1=O |
| InChI | InChI=1S/C19H26F2N2O9/c1-11-15(24)23(18(27,28)19(29,30)31)10-16(32-11)4-6-22(7-5-16)17(25,26)9-12-8-13(20)2-3-14(12)21/h2-3,8,11,25-31H,4-7,9-10H2,1H3 |
| InChIKey | VYZAKDKSKXHBFI-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 174.39 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|