C9H10F5N — CID 139425186
1-(3,3-difluoro-2,4-dimethylcyclopenten-1-yl)-2,2,2-trifluoroethanimine (PubChem CID 139425186) has the molecular formula C9H10F5N and a molecular weight of 227.18 g/mol. Its IUPAC name is 1-(3,3-difluoro-2,4-dimethylcyclopenten-1-yl)-2,2,2-trifluoroethanimine.
| Compound Name | 1-(3,3-difluoro-2,4-dimethylcyclopenten-1-yl)-2,2,2-trifluoroethanimine |
|---|---|
| PubChem CID | 139425186 |
| Molecular Formula | C9H10F5N |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 1-(3,3-difluoro-2,4-dimethylcyclopenten-1-yl)-2,2,2-trifluoroethanimine |
| SMILES | [H]/N=C(/C1=C(C)C(F)(F)C(C)C1)C(F)(F)F |
| InChI | InChI=1S/C9H10F5N/c1-4-3-6(5(2)8(4,10)11)7(15)9(12,13)14/h4,15H,3H2,1-2H3/b15-7- |
| InChIKey | NCWUDCGRAODBFI-CHHVJCJISA-N |
| XLogP | 3.56 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|