C12H16F5N — CID 139425189
1-(5-ethyl-3,3-difluoro-2,4,5-trimethylcyclopenten-1-yl)-2,2,2-trifluoroethanimine (PubChem CID 139425189) has the molecular formula C12H16F5N and a molecular weight of 269.26 g/mol. Its IUPAC name is 1-(5-ethyl-3,3-difluoro-2,4,5-trimethylcyclopenten-1-yl)-2,2,2-trifluoroethanimine.
| Compound Name | 1-(5-ethyl-3,3-difluoro-2,4,5-trimethylcyclopenten-1-yl)-2,2,2-trifluoroethanimine |
|---|---|
| PubChem CID | 139425189 |
| Molecular Formula | C12H16F5N |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-(5-ethyl-3,3-difluoro-2,4,5-trimethylcyclopenten-1-yl)-2,2,2-trifluoroethanimine |
| SMILES | [H]/N=C(/C1=C(C)C(F)(F)C(C)C1(C)CC)C(F)(F)F |
| InChI | InChI=1S/C12H16F5N/c1-5-10(4)7(3)11(13,14)6(2)8(10)9(18)12(15,16)17/h7,18H,5H2,1-4H3/b18-9- |
| InChIKey | MCUFJRMWJZLZAS-NVMNQCDNSA-N |
| XLogP | 4.59 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|