About 5-methyl-3-(2,2,2-trifluoroethanimidoyl)cyclopent-2-en-1-one
5-methyl-3-(2,2,2-trifluoroethanimidoyl)cyclopent-2-en-1-one (PubChem CID 139425202) has the molecular formula C8H8F3NO
and a molecular weight of 191.15 g/mol. Its IUPAC name is 5-methyl-3-(2,2,2-trifluoroethanimidoyl)cyclopent-2-en-1-one.
Molecular Properties
| Compound Name | 5-methyl-3-(2,2,2-trifluoroethanimidoyl)cyclopent-2-en-1-one |
| PubChem CID | 139425202 |
| Molecular Formula | C8H8F3NO |
| Molecular Weight | 191.15 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 5-methyl-3-(2,2,2-trifluoroethanimidoyl)cyclopent-2-en-1-one |
| SMILES | [H]/N=C(/C1=CC(=O)C(C)C1)C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO/c1-4-2-5(3-6(4)13)7(12)8(9,10)11/h3-4,12H,2H2,1H3/b12-7- |
| InChIKey | YHYMMJSCTLWOMK-GHXNOFRVSA-N |
| XLogP | 2.10 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.15 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3-(2,2,2-trifluoroethanimidoyl)cyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-(2,2,2-trifluoroethanimidoyl)cyclopent-2-en-1-one?
The IUPAC name of 5-methyl-3-(2,2,2-trifluoroethanimidoyl)cyclopent-2-en-1-one (CID 139425202) is 5-methyl-3-(2,2,2-trifluoroethanimidoyl)cyclopent-2-en-1-one.
What is the SMILES notation for 5-methyl-3-(2,2,2-trifluoroethanimidoyl)cyclopent-2-en-1-one?
The canonical SMILES for 5-methyl-3-(2,2,2-trifluoroethanimidoyl)cyclopent-2-en-1-one is [H]/N=C(/C1=CC(=O)C(C)C1)C(F)(F)F.
What is the InChIKey of 5-methyl-3-(2,2,2-trifluoroethanimidoyl)cyclopent-2-en-1-one?
The InChIKey is YHYMMJSCTLWOMK-GHXNOFRVSA-N. The full InChI is InChI=1S/C8H8F3NO/c1-4-2-5(3-6(4)13)7(12)8(9,10)11/h3-4,12H,2H2,1H3/b12-7-.
What are the key properties of 5-methyl-3-(2,2,2-trifluoroethanimidoyl)cyclopent-2-en-1-one?
5-methyl-3-(2,2,2-trifluoroethanimidoyl)cyclopent-2-en-1-one has a molecular weight of 191.15 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-(2,2,2-trifluoroethanimidoyl)cyclopent-2-en-1-one is sourced from PubChem (CID 139425202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).