C10H10F5N — CID 139425215
1-(3,3-difluoro-2,4-dimethyl-5-methylidenecyclopenten-1-yl)-2,2,2-trifluoroethanimine (PubChem CID 139425215) has the molecular formula C10H10F5N and a molecular weight of 239.19 g/mol. Its IUPAC name is 1-(3,3-difluoro-2,4-dimethyl-5-methylidenecyclopenten-1-yl)-2,2,2-trifluoroethanimine.
| Compound Name | 1-(3,3-difluoro-2,4-dimethyl-5-methylidenecyclopenten-1-yl)-2,2,2-trifluoroethanimine |
|---|---|
| PubChem CID | 139425215 |
| Molecular Formula | C10H10F5N |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 1-(3,3-difluoro-2,4-dimethyl-5-methylidenecyclopenten-1-yl)-2,2,2-trifluoroethanimine |
| SMILES | [H]/N=C(/C1=C(C)C(F)(F)C(C)C1=C)C(F)(F)F |
| InChI | InChI=1S/C10H10F5N/c1-4-5(2)9(11,12)6(3)7(4)8(16)10(13,14)15/h5,16H,1H2,2-3H3/b16-8- |
| InChIKey | HIVROVAQWCCGAP-PXNMLYILSA-N |
| XLogP | 3.73 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|