About 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-methyl-3-azaspiro[5.5]undecane-8,10-dione
9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-methyl-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 139425359) has the molecular formula C22H27NO2
and a molecular weight of 337.46 g/mol. Its IUPAC name is 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-methyl-3-azaspiro[5.5]undecane-8,10-dione.
Molecular Properties
| Compound Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-methyl-3-azaspiro[5.5]undecane-8,10-dione |
| PubChem CID | 139425359 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-methyl-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC3(CCN(C)CC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C22H27NO2/c1-5-6-17-11-15(2)20(16(3)12-17)21-18(24)13-22(14-19(21)25)7-9-23(4)10-8-22/h11-12,21H,7-10,13-14H2,1-4H3 |
| InChIKey | MESDMNLSTOGXKG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-methyl-3-azaspiro[5.5]undecane-8,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-methyl-3-azaspiro[5.5]undecane-8,10-dione?
The IUPAC name of 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-methyl-3-azaspiro[5.5]undecane-8,10-dione (CID 139425359) is 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-methyl-3-azaspiro[5.5]undecane-8,10-dione.
What is the SMILES notation for 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-methyl-3-azaspiro[5.5]undecane-8,10-dione?
The canonical SMILES for 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-methyl-3-azaspiro[5.5]undecane-8,10-dione is CC#Cc1cc(C)c(C2C(=O)CC3(CCN(C)CC3)CC2=O)c(C)c1.
What is the InChIKey of 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-methyl-3-azaspiro[5.5]undecane-8,10-dione?
The InChIKey is MESDMNLSTOGXKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO2/c1-5-6-17-11-15(2)20(16(3)12-17)21-18(24)13-22(14-19(21)25)7-9-23(4)10-8-22/h11-12,21H,7-10,13-14H2,1-4H3.
What are the key properties of 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-methyl-3-azaspiro[5.5]undecane-8,10-dione?
9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-methyl-3-azaspiro[5.5]undecane-8,10-dione has a molecular weight of 337.46 g/mol, XLogP of 3.40, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-methyl-3-azaspiro[5.5]undecane-8,10-dione is sourced from PubChem (CID 139425359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).