C23H26F3NO2 — CID 139425406
9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(2,2,2-trifluoroethyl)-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 139425406) has the molecular formula C23H26F3NO2 and a molecular weight of 405.46 g/mol. Its IUPAC name is 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(2,2,2-trifluoroethyl)-3-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(2,2,2-trifluoroethyl)-3-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 139425406 |
| Molecular Formula | C23H26F3NO2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(2,2,2-trifluoroethyl)-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC3(CCN(CC(F)(F)F)CC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C23H26F3NO2/c1-4-5-17-10-15(2)20(16(3)11-17)21-18(28)12-22(13-19(21)29)6-8-27(9-7-22)14-23(24,25)26/h10-11,21H,6-9,12-14H2,1-3H3 |
| InChIKey | OFNTZYNKYUTSDO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|