C25H30FNO3 — CID 139425490
9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(2-fluoro-2-methylpropanoyl)-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 139425490) has the molecular formula C25H30FNO3 and a molecular weight of 411.52 g/mol. Its IUPAC name is 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(2-fluoro-2-methylpropanoyl)-3-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(2-fluoro-2-methylpropanoyl)-3-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 139425490 |
| Molecular Formula | C25H30FNO3 |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(2-fluoro-2-methylpropanoyl)-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC3(CCN(C(=O)C(C)(C)F)CC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C25H30FNO3/c1-6-7-18-12-16(2)21(17(3)13-18)22-19(28)14-25(15-20(22)29)8-10-27(11-9-25)23(30)24(4,5)26/h12-13,22H,8-11,14-15H2,1-5H3 |
| InChIKey | HTWVRAVAHCJQGS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|