C25H28F3NO3 — CID 139425503
9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(3,3,3-trifluoro-2-methylpropanoyl)-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 139425503) has the molecular formula C25H28F3NO3 and a molecular weight of 447.50 g/mol. Its IUPAC name is 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(3,3,3-trifluoro-2-methylpropanoyl)-3-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(3,3,3-trifluoro-2-methylpropanoyl)-3-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 139425503 |
| Molecular Formula | C25H28F3NO3 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(3,3,3-trifluoro-2-methylpropanoyl)-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC3(CCN(C(=O)C(C)C(F)(F)F)CC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C25H28F3NO3/c1-5-6-18-11-15(2)21(16(3)12-18)22-19(30)13-24(14-20(22)31)7-9-29(10-8-24)23(32)17(4)25(26,27)28/h11-12,17,22H,7-10,13-14H2,1-4H3 |
| InChIKey | YLLNWHDCCNZHOR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|