About 3-(ethylamino)-1-[(1R,2S)-2-hydroxycyclohexyl]pyridin-2-one
3-(ethylamino)-1-[(1R,2S)-2-hydroxycyclohexyl]pyridin-2-one (PubChem CID 139425521) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-(ethylamino)-1-[(1R,2S)-2-hydroxycyclohexyl]pyridin-2-one.
Molecular Properties
| Compound Name | 3-(ethylamino)-1-[(1R,2S)-2-hydroxycyclohexyl]pyridin-2-one |
| PubChem CID | 139425521 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 3-(ethylamino)-1-[(1R,2S)-2-hydroxycyclohexyl]pyridin-2-one |
| SMILES | CCNc1cccn([C@@H]2CCCC[C@@H]2O)c1=O |
| InChI | InChI=1S/C13H20N2O2/c1-2-14-10-6-5-9-15(13(10)17)11-7-3-4-8-12(11)16/h5-6,9,11-12,14,16H,2-4,7-8H2,1H3/t11-,12+/m1/s1 |
| InChIKey | GWBKOCVKDHSAIM-NEPJUHHUSA-N |
| XLogP | 1.76 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(ethylamino)-1-[(1R,2S)-2-hydroxycyclohexyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethylamino)-1-[(1R,2S)-2-hydroxycyclohexyl]pyridin-2-one?
The IUPAC name of 3-(ethylamino)-1-[(1R,2S)-2-hydroxycyclohexyl]pyridin-2-one (CID 139425521) is 3-(ethylamino)-1-[(1R,2S)-2-hydroxycyclohexyl]pyridin-2-one.
What is the SMILES notation for 3-(ethylamino)-1-[(1R,2S)-2-hydroxycyclohexyl]pyridin-2-one?
The canonical SMILES for 3-(ethylamino)-1-[(1R,2S)-2-hydroxycyclohexyl]pyridin-2-one is CCNc1cccn([C@@H]2CCCC[C@@H]2O)c1=O.
What is the InChIKey of 3-(ethylamino)-1-[(1R,2S)-2-hydroxycyclohexyl]pyridin-2-one?
The InChIKey is GWBKOCVKDHSAIM-NEPJUHHUSA-N. The full InChI is InChI=1S/C13H20N2O2/c1-2-14-10-6-5-9-15(13(10)17)11-7-3-4-8-12(11)16/h5-6,9,11-12,14,16H,2-4,7-8H2,1H3/t11-,12+/m1/s1.
What are the key properties of 3-(ethylamino)-1-[(1R,2S)-2-hydroxycyclohexyl]pyridin-2-one?
3-(ethylamino)-1-[(1R,2S)-2-hydroxycyclohexyl]pyridin-2-one has a molecular weight of 236.31 g/mol, XLogP of 1.76, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylamino)-1-[(1R,2S)-2-hydroxycyclohexyl]pyridin-2-one is sourced from PubChem (CID 139425521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).