C24H31FN4O2 — CID 139426654
4-[[(1S)-1-[4-[(cyclohexylamino)-hydroxymethyl]-3-fluorophenyl]ethyl]amino]-2-ethyl-3H-pyrrolo[3,4-c]pyridin-1-one (PubChem CID 139426654) has the molecular formula C24H31FN4O2 and a molecular weight of 426.54 g/mol. Its IUPAC name is 4-[[(1S)-1-[4-[(cyclohexylamino)-hydroxymethyl]-3-fluorophenyl]ethyl]amino]-2-ethyl-3H-pyrrolo[3,4-c]pyridin-1-one.
| Compound Name | 4-[[(1S)-1-[4-[(cyclohexylamino)-hydroxymethyl]-3-fluorophenyl]ethyl]amino]-2-ethyl-3H-pyrrolo[3,4-c]pyridin-1-one |
|---|---|
| PubChem CID | 139426654 |
| Molecular Formula | C24H31FN4O2 |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 4-[[(1S)-1-[4-[(cyclohexylamino)-hydroxymethyl]-3-fluorophenyl]ethyl]amino]-2-ethyl-3H-pyrrolo[3,4-c]pyridin-1-one |
| SMILES | CCN1Cc2c(ccnc2N[C@@H](C)c2ccc(C(O)NC3CCCCC3)c(F)c2)C1=O |
| InChI | InChI=1S/C24H31FN4O2/c1-3-29-14-20-18(24(29)31)11-12-26-22(20)27-15(2)16-9-10-19(21(25)13-16)23(30)28-17-7-5-4-6-8-17/h9-13,15,17,23,28,30H,3-8,14H2,1-2H3,(H,26,27)/t15-,23?/m0/s1 |
| InChIKey | FLNNTPLYSACDCQ-NGMICRHFSA-N |
| XLogP | 4.28 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|