C21H32N4 — CID 139426731
4-N-(3-cyclohexyl-6-ethenylimino-5-methyliminocyclohexa-1,3-dien-1-yl)cyclohexane-1,4-diamine (PubChem CID 139426731) has the molecular formula C21H32N4 and a molecular weight of 340.51 g/mol. Its IUPAC name is 4-N-(3-cyclohexyl-6-ethenylimino-5-methyliminocyclohexa-1,3-dien-1-yl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-(3-cyclohexyl-6-ethenylimino-5-methyliminocyclohexa-1,3-dien-1-yl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 139426731 |
| Molecular Formula | C21H32N4 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 4-N-(3-cyclohexyl-6-ethenylimino-5-methyliminocyclohexa-1,3-dien-1-yl)cyclohexane-1,4-diamine |
| SMILES | C=C/N=C1/C(NC2CCC(N)CC2)=CC(C2CCCCC2)=C/C1=N\C |
| InChI | InChI=1S/C21H32N4/c1-3-24-21-19(23-2)13-16(15-7-5-4-6-8-15)14-20(21)25-18-11-9-17(22)10-12-18/h3,13-15,17-18,25H,1,4-12,22H2,2H3/b23-19+,24-21+ |
| InChIKey | IIQLEKNCUFBAOG-XGXYRHPYSA-N |
| XLogP | 3.91 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|