About N-[(4R)-3,3-dimethyl-1-oxa-8-azaspiro[4.5]decan-4-yl]-2-methylpropane-2-sulfinamide
N-[(4R)-3,3-dimethyl-1-oxa-8-azaspiro[4.5]decan-4-yl]-2-methylpropane-2-sulfinamide (PubChem CID 139427235) has the molecular formula C14H28N2O2S
and a molecular weight of 288.46 g/mol. Its IUPAC name is N-[(4R)-3,3-dimethyl-1-oxa-8-azaspiro[4.5]decan-4-yl]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | N-[(4R)-3,3-dimethyl-1-oxa-8-azaspiro[4.5]decan-4-yl]-2-methylpropane-2-sulfinamide |
| PubChem CID | 139427235 |
| Molecular Formula | C14H28N2O2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | N-[(4R)-3,3-dimethyl-1-oxa-8-azaspiro[4.5]decan-4-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC1(C)COC2(CCNCC2)[C@@H]1NS(=O)C(C)(C)C |
| InChI | InChI=1S/C14H28N2O2S/c1-12(2,3)19(17)16-11-13(4,5)10-18-14(11)6-8-15-9-7-14/h11,15-16H,6-10H2,1-5H3/t11-,19?/m1/s1 |
| InChIKey | XBSQNOHQABSODN-AMIJKRQISA-N |
| XLogP | 1.59 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(4R)-3,3-dimethyl-1-oxa-8-azaspiro[4.5]decan-4-yl]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4R)-3,3-dimethyl-1-oxa-8-azaspiro[4.5]decan-4-yl]-2-methylpropane-2-sulfinamide?
The IUPAC name of N-[(4R)-3,3-dimethyl-1-oxa-8-azaspiro[4.5]decan-4-yl]-2-methylpropane-2-sulfinamide (CID 139427235) is N-[(4R)-3,3-dimethyl-1-oxa-8-azaspiro[4.5]decan-4-yl]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for N-[(4R)-3,3-dimethyl-1-oxa-8-azaspiro[4.5]decan-4-yl]-2-methylpropane-2-sulfinamide?
The canonical SMILES for N-[(4R)-3,3-dimethyl-1-oxa-8-azaspiro[4.5]decan-4-yl]-2-methylpropane-2-sulfinamide is CC1(C)COC2(CCNCC2)[C@@H]1NS(=O)C(C)(C)C.
What is the InChIKey of N-[(4R)-3,3-dimethyl-1-oxa-8-azaspiro[4.5]decan-4-yl]-2-methylpropane-2-sulfinamide?
The InChIKey is XBSQNOHQABSODN-AMIJKRQISA-N. The full InChI is InChI=1S/C14H28N2O2S/c1-12(2,3)19(17)16-11-13(4,5)10-18-14(11)6-8-15-9-7-14/h11,15-16H,6-10H2,1-5H3/t11-,19?/m1/s1.
What are the key properties of N-[(4R)-3,3-dimethyl-1-oxa-8-azaspiro[4.5]decan-4-yl]-2-methylpropane-2-sulfinamide?
N-[(4R)-3,3-dimethyl-1-oxa-8-azaspiro[4.5]decan-4-yl]-2-methylpropane-2-sulfinamide has a molecular weight of 288.46 g/mol, XLogP of 1.59, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4R)-3,3-dimethyl-1-oxa-8-azaspiro[4.5]decan-4-yl]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 139427235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).